![[I]](pic/icon/comment.png){kind=icon}
Add comment
![[I]](pic/icon/photo.png){kind=icon}
Add picture
Ukraine
You are currently not logged in. You can still browse the encyclopedia, but for more functionality please login or register! Registration is FREE!
| Add comment
Add picture
|
|
|---|---|
| ID | 851 |
| Name | Aviatrans Kiev |
| # of related pictures | |
| ICAO | KCA |
| IATA | KI |
| CallSign | TRANS KIEV |
| Country |
Ukraine
|
| Founded | ? |
| Defunct | |
| Destinations | |
| Fleet size | 3 |
| Info (external) | https://en.wikipedia.org/wiki/Aviatrans_Kiev |
| Website | |
| Successor | |
| # of related collections | |
| # of related user comments |