![[I]](pic/icon/comment.png){kind=icon}
Add comment
![[I]](pic/icon/photo.png){kind=icon}
Add picture
Canada
![[I]](pic/icon/map.png){kind=icon}
N511130 W1153329You are currently not logged in. You can still browse the encyclopedia, but for more functionality please login or register! Registration is FREE!
| Add comment
Add picture
|
|
|---|---|
| ICAO code | __CBP2 |
| Name | Banff (Park Compound Heliport) Heliport |
| # of related pictures | |
| IATA code | |
| Country |
Canada
|
| Geolocation | N511130 W1153329 |
| Municipality | Banff |
| Type | Heliport |
| Elevation (ft) | 4 570 |
| Longest runwaylength (m) | |
| Passengers [in 2018]* | |
| Info (external) | |
| Website (external) | |
| # of related air shows in DB | |
| # of related air museums in DB | |
| # of aeroclubs in DB | |
| # of related collections | |
| # of related user comments |
Geolocation format: e.g. N472044 E0185851 = 47 degree 20 minutes 44 seconds north, 018 degree 58 minutes 51 seconds east.